CAS 1172413-56-7 is the registry number for 7-Bromo-4-hydrazinoquinoline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(7-bromoquinolin-4-yl)hydrazine;hydrochloride (CAS 1172413-56-7) is a chemical compound with the molecular formula C9H9BrClN3 and a molecular weight of 274.54 g/mol. IUPAC name: (7-bromoquinolin-4-yl)hydrazine;hydrochloride. InChIKey: FLALHEMXXUMGJK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN3 |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | (7-bromoquinolin-4-yl)hydrazine;hydrochloride |
| InChIKey | FLALHEMXXUMGJK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Br)NN.Cl |
Computed by PubChem (NCBI)