Products 2654003-05-9

CAS 2654003-05-9 is the registry number for 8-bromo-6-chloro-3-isopropyl-imidazo[1,2-b]pyridazine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

8-bromo-6-chloro-3-propan-2-ylimidazo[1,2-b]pyridazine (CAS 2654003-05-9) is a chemical compound with the molecular formula C9H9BrClN3 and a molecular weight of 274.54 g/mol. IUPAC name: 8-bromo-6-chloro-3-propan-2-ylimidazo[1,2-b]pyridazine. InChIKey: NAUSRUDYPBONFW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrClN3
Molecular weight274.54 g/mol
IUPAC name8-bromo-6-chloro-3-propan-2-ylimidazo[1,2-b]pyridazine
InChIKeyNAUSRUDYPBONFW-UHFFFAOYSA-N
SMILESCC(C)C1=CN=C2N1N=C(C=C2Br)Cl

Computed by PubChem (NCBI)