CAS 870706-48-2 is the registry number for 5-Bromo-4-chloro-7-isopropyl-7H-pyrrolo(2,3-d)pyrimidine, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5-bromo-4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine (CAS 870706-48-2) is a chemical compound with the molecular formula C9H9BrClN3 and a molecular weight of 274.54 g/mol. IUPAC name: 5-bromo-4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine. InChIKey: ARSZZBPXLBCJRY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN3 |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 5-bromo-4-chloro-7-propan-2-ylpyrrolo[2,3-d]pyrimidine |
| InChIKey | ARSZZBPXLBCJRY-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C2=C1N=CN=C2Cl)Br |
Computed by PubChem (NCBI)