Products 885720-87-6
CAS 885720-87-6 appears in our catalog under these names: 3-Bromo-7-chloro-6-ethyl-5-methylpyrazolo[1,5-a]pyrimidine, 95%, 3-Bromo-7-chloro-6-ethyl-5-methylpyrazolo[1,5-a]pyrimidine, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
3-bromo-7-chloro-6-ethyl-5-methylpyrazolo[1,5-a]pyrimidine (CAS 885720-87-6) is a chemical compound with the molecular formula C9H9BrClN3 and a molecular weight of 274.54 g/mol. IUPAC name: 3-bromo-7-chloro-6-ethyl-5-methylpyrazolo[1,5-a]pyrimidine. InChIKey: NDSGMGQUNZXDTA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN3 |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 3-bromo-7-chloro-6-ethyl-5-methylpyrazolo[1,5-a]pyrimidine |
| InChIKey | NDSGMGQUNZXDTA-UHFFFAOYSA-N |
| SMILES | CCC1=C(N2C(=C(C=N2)Br)N=C1C)Cl |
Computed by PubChem (NCBI)