Products 2765335-88-2
CAS 2765335-88-2 is the registry number for 8-Bromo-6-chloro-3-isopropylimidazo[1,2-a]pyrazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-chloro-3-propan-2-ylimidazo[1,2-a]pyrazine (CAS 2765335-88-2) is a chemical compound with the molecular formula C9H9BrClN3 and a molecular weight of 274.54 g/mol. IUPAC name: 8-bromo-6-chloro-3-propan-2-ylimidazo[1,2-a]pyrazine. InChIKey: NELLIBHFIFMVLS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN3 |
|---|---|
| Molecular weight | 274.54 g/mol |
| IUPAC name | 8-bromo-6-chloro-3-propan-2-ylimidazo[1,2-a]pyrazine |
| InChIKey | NELLIBHFIFMVLS-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN=C2N1C=C(N=C2Br)Cl |
Computed by PubChem (NCBI)