CAS 1172561-37-3 is the registry number for 4-Phenoxyphenylglyoxal hydrate, 95%. Offered by: AmBeed. Available pack sizes: 10g.
2-oxo-2-(4-phenoxyphenyl)acetaldehyde;hydrate (CAS 1172561-37-3) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-oxo-2-(4-phenoxyphenyl)acetaldehyde;hydrate. InChIKey: AVDIBXWPGWASQM-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-oxo-2-(4-phenoxyphenyl)acetaldehyde;hydrate |
| InChIKey | AVDIBXWPGWASQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)C=O.O |
Computed by PubChem (NCBI)