CAS 1172734-38-1 is the registry number for 4-(5-(Aminomethyl)furan-2-yl)benzene-1-sulfonamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[5-(aminomethyl)furan-2-yl]benzenesulfonamide;hydrochloride (CAS 1172734-38-1) is a chemical compound with the molecular formula C11H13ClN2O3S and a molecular weight of 288.75 g/mol. IUPAC name: 4-[5-(aminomethyl)furan-2-yl]benzenesulfonamide;hydrochloride. InChIKey: AJXNKSKYWVYKCA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 4-[5-(aminomethyl)furan-2-yl]benzenesulfonamide;hydrochloride |
| InChIKey | AJXNKSKYWVYKCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)CN)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)