CAS 914348-64-4 is the registry number for 4-Chloro-2-(4-carbomethoxyl-1-piperidinyl)-5-thiazolecarboxaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-4-carboxylate (CAS 914348-64-4) is a chemical compound with the molecular formula C11H13ClN2O3S and a molecular weight of 288.75 g/mol. IUPAC name: methyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-4-carboxylate. InChIKey: ALFXRLGWNCUESD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | methyl 1-(4-chloro-5-formyl-1,3-thiazol-2-yl)piperidine-4-carboxylate |
| InChIKey | ALFXRLGWNCUESD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(CC1)C2=NC(=C(S2)C=O)Cl |
Computed by PubChem (NCBI)