CAS 928937-04-6 appears in our catalog under these names: 4-(4-Chlorobenzenesulfonyl)piperazine-1-carbaldehyde, 98%, 4-(4-Chlorobenzenesulfonyl)piperazine-1-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(4-chlorophenyl)sulfonylpiperazine-1-carbaldehyde (CAS 928937-04-6) is a chemical compound with the molecular formula C11H13ClN2O3S and a molecular weight of 288.75 g/mol. IUPAC name: 4-(4-chlorophenyl)sulfonylpiperazine-1-carbaldehyde. InChIKey: IRJXXJRNJVPONF-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 4-(4-chlorophenyl)sulfonylpiperazine-1-carbaldehyde |
| InChIKey | IRJXXJRNJVPONF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C=O)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)