Products 385400-72-6
CAS 385400-72-6 is the registry number for 1-((4-Chlorophenyl)sulfonyl)-1,4-diazepan-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorophenyl)sulfonyl-1,4-diazepan-5-one (CAS 385400-72-6) is a chemical compound with the molecular formula C11H13ClN2O3S and a molecular weight of 288.75 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonyl-1,4-diazepan-5-one. InChIKey: IKMFAYJPQXCNCB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonyl-1,4-diazepan-5-one |
| InChIKey | IKMFAYJPQXCNCB-UHFFFAOYSA-N |
| SMILES | C1CN(CCNC1=O)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)