CAS 1179731-43-1 is the registry number for 4-Chloro-N-(3-methyl-1,1-dioxidotetrahydrothiophen-3-yl)picolinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide (CAS 1179731-43-1) is a chemical compound with the molecular formula C11H13ClN2O3S and a molecular weight of 288.75 g/mol. IUPAC name: 4-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide. InChIKey: WTVDOTBCSJXXIX-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 4-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)pyridine-2-carboxamide |
| InChIKey | WTVDOTBCSJXXIX-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C1)NC(=O)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)