CAS 1173019-62-9 appears in our catalog under these names: 4-n-Nonylphenol-2,3,5,6-d4, >95% (HPLC), 4-n-Nonylphenol D4 (phenyl D4) 100 µg/mL in Acetone, 4–Nonylphenol–2,3,5,6–d4. Offered by: TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 2,5mg, 25mg, 5mg, 1ml, 1mg, 10mg.
2,3,5,6-tetradeuterio-4-nonylphenol (CAS 1173019-62-9) is a chemical compound with the molecular formula C15H24O and a molecular weight of 224.37 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-nonylphenol. InChIKey: IGFHQQFPSIBGKE-ZGAVCIBUSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 224.37 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-nonylphenol |
| InChIKey | IGFHQQFPSIBGKE-ZGAVCIBUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCCCCCCC)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)