CAS 358730-95-7 appears in our catalog under these names: 4-n-Nonylphenol-D5, 4-n-Nonylphenol-2,3,5,6-d4,OD, 98 atom % D, min 98% Chemical Purity, 4–Nonylphenol–d5, D4-4-n-Nonylphenol, Concentration: 100 µg/ml Solvent: Acetone, 4-Nonylphenol-d5, 99.22%. Offered by: Chemat Brand, CDN, GLPBio, HPC Standards, MedChemExpress. Available pack sizes: on request, 0,25g, 0,1g, 1mg, 10mg, 5mg, 1x1ml, 10 mg.
1,2,4,5-tetradeuterio-3-deuteriooxy-6-nonylbenzene (CAS 358730-95-7) is a chemical compound with the molecular formula C15H24O and a molecular weight of 225.38 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3-deuteriooxy-6-nonylbenzene. InChIKey: IGFHQQFPSIBGKE-VQUAKUOWSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 225.38 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3-deuteriooxy-6-nonylbenzene |
| InChIKey | IGFHQQFPSIBGKE-VQUAKUOWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCCCCCCC)[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)