CAS 211947-56-7 appears in our catalog under these names: 4-Nonyl Phenol-13C6, 13C6-4-n-Nonylphenol, 13C6-4-n-Nonylphenol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, HPC Standards. Available pack sizes: 10mg, 1mg, 1x5mg, 1x1ml.
4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 211947-56-7) is a chemical compound with the molecular formula C15H24O and a molecular weight of 226.31 g/mol. IUPAC name: 4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: IGFHQQFPSIBGKE-RWFIAFQRSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | 4-nonyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | IGFHQQFPSIBGKE-RWFIAFQRSA-N |
| SMILES | CCCCCCCCC[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |
Computed by PubChem (NCBI)