CAS 1173021-97-0 is the registry number for 4-Fluoro-2-(1-phenyl-1h-pyrazol-5-yl)phenol acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-fluoro-2-(2-phenylpyrazol-3-yl)phenyl] acetate (CAS 1173021-97-0) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: [4-fluoro-2-(2-phenylpyrazol-3-yl)phenyl] acetate. InChIKey: FMBSJGKYPDHBCU-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | [4-fluoro-2-(2-phenylpyrazol-3-yl)phenyl] acetate |
| InChIKey | FMBSJGKYPDHBCU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)F)C2=CC=NN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)