CAS 618102-27-5 appears in our catalog under these names: 1-(2-Fluorophenyl)-3-(p-tolyl)-1H-pyrazole-5-carboxylic acid, 95+%, 1-(2-Fluorophenyl)-3-p-tolyl-1H-pyrazole-5-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1000mg, 5000mg.
1-(2-fluorophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid (CAS 618102-27-5) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: 1-(2-fluorophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid. InChIKey: ZUBPIFPXNFKHGG-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-3-(4-methylphenyl)pyrazole-5-carboxylic acid |
| InChIKey | ZUBPIFPXNFKHGG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=CC=C3F |
Computed by PubChem (NCBI)