CAS 727652-29-1 is the registry number for 3-(2-(4-Fluorophenyl)-7-methylimidazo(1,2-a)pyridin-3-yl)acrylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(E)-3-[2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid (CAS 727652-29-1) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: (E)-3-[2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid. InChIKey: TULQDWPLGAOFRM-VOTSOKGWSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | (E)-3-[2-(4-fluorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid |
| InChIKey | TULQDWPLGAOFRM-VOTSOKGWSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)/C=C/C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)