CAS 339012-94-1 is the registry number for 2-[Cyano(3,4-dimethoxyphenyl)methyl]-6-fluorobenzenecarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-[cyano-(3,4-dimethoxyphenyl)methyl]-6-fluorobenzonitrile (CAS 339012-94-1) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: 2-[cyano-(3,4-dimethoxyphenyl)methyl]-6-fluorobenzonitrile. InChIKey: KXMBKWZKMWJTRI-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | 2-[cyano-(3,4-dimethoxyphenyl)methyl]-6-fluorobenzonitrile |
| InChIKey | KXMBKWZKMWJTRI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C#N)C2=C(C(=CC=C2)F)C#N)OC |
Computed by PubChem (NCBI)