Products 372490-42-1

CAS 372490-42-1 is the registry number for Piraxostat Impurity 38. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate (CAS 372490-42-1) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate. InChIKey: ZCXFISMVVPTCRO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13FN2O2
Molecular weight296.29 g/mol
IUPAC namemethyl 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate
InChIKeyZCXFISMVVPTCRO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN(N=C1C2=CC=C(C=C2)F)C3=CC=CC=C3

Computed by PubChem (NCBI)