CAS 372490-42-1 is the registry number for Piraxostat Impurity 38. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate (CAS 372490-42-1) is a chemical compound with the molecular formula C17H13FN2O2 and a molecular weight of 296.29 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate. InChIKey: ZCXFISMVVPTCRO-UHFFFAOYSA-N.
| Molecular formula | C17H13FN2O2 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate |
| InChIKey | ZCXFISMVVPTCRO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(N=C1C2=CC=C(C=C2)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)