Products 1173022-79-1
CAS 1173022-79-1 is the registry number for 3-Hydroxybutanoic acid-13C (sodium). Offered by: MedChemExpress. Available pack sizes: 1 mg.
Sodium 3-hydroxy(113C)butanoate (CAS 1173022-79-1) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 127.08 g/mol. IUPAC name: sodium 3-hydroxy(113C)butanoate. InChIKey: NBPUSGBJDWCHKC-VZHAHHFWSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 127.08 g/mol |
| IUPAC name | sodium 3-hydroxy(113C)butanoate |
| InChIKey | NBPUSGBJDWCHKC-VZHAHHFWSA-M |
| SMILES | CC(C[13C](=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)