CAS 117402-88-7 appears in our catalog under these names: Z-D-Phe(4-NO2)-OH, 97%, Z-D-Phe(4-NO2)-OH, 95%, 95%, Z-D-Phe(4-NO2)-OH, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
(2R)-3-(4-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 117402-88-7) is a chemical compound with the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. IUPAC name: (2R)-3-(4-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: UORCURAKJUSAHL-OAHLLOKOSA-N.
| Molecular formula | C17H16N2O6 |
|---|---|
| Molecular weight | 344.32 g/mol |
| IUPAC name | (2R)-3-(4-nitrophenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | UORCURAKJUSAHL-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)