Products 89267-42-5
CAS 89267-42-5 appears in our catalog under these names: Nitrendipine Impurity 42, Lercanidipine Impurity 1, Nitrendipine Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-ethoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid (CAS 89267-42-5) is a chemical compound with the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. IUPAC name: 5-ethoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid. InChIKey: LFBBVVFUCYMPCG-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O6 |
|---|---|
| Molecular weight | 344.32 g/mol |
| IUPAC name | 5-ethoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid |
| InChIKey | LFBBVVFUCYMPCG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N=C1C)C)C(=O)O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)