Products 159435-02-6
CAS 159435-02-6 is the registry number for 4-Dimethylamino-2-hydroxy-2’-methoxycarbonyl-5’-nitrobenzophenone. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Methyl 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoate (CAS 159435-02-6) is a chemical compound with the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. IUPAC name: methyl 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoate. InChIKey: WUPOAAZRMLZXEJ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O6 |
|---|---|
| Molecular weight | 344.32 g/mol |
| IUPAC name | methyl 2-[4-(dimethylamino)-2-hydroxybenzoyl]-4-nitrobenzoate |
| InChIKey | WUPOAAZRMLZXEJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])C(=O)OC)O |
Computed by PubChem (NCBI)