CAS 76258-20-3 appears in our catalog under these names: Dimethyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate, 95%, Nicardipine Related Compound 1, Nifedipine Impurity 47, Dimethyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate 95%. Offered by: Combi-blocks, Chemat Brand, Ambeed. Available pack sizes: 1g, 5g, on request, 250mg.
Dimethyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 76258-20-3) is a chemical compound with the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. IUPAC name: dimethyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: WLSSRGYMMSQMGL-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O6 |
|---|---|
| Molecular weight | 344.32 g/mol |
| IUPAC name | dimethyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | WLSSRGYMMSQMGL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)