Products 125464-52-0
CAS 125464-52-0 appears in our catalog under these names: Dehydro Nifedipine-d6, >95% (HPLC), Dehydro Nifedipine-d6, Nifedipine dehydro nitroso-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg, Get quote.
Bis(trideuteriomethyl) 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 125464-52-0) is a chemical compound with the molecular formula C17H16N2O6 and a molecular weight of 350.35 g/mol. IUPAC name: bis(trideuteriomethyl) 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: UMQHJQGNGLQJPF-LIJFRPJRSA-N.
| Molecular formula | C17H16N2O6 |
|---|---|
| Molecular weight | 350.35 g/mol |
| IUPAC name | bis(trideuteriomethyl) 2,6-dimethyl-4-(2-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | UMQHJQGNGLQJPF-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=C(N=C(C(=C1C2=CC=CC=C2[N+](=O)[O-])C(=O)OC([2H])([2H])[2H])C)C |
Computed by PubChem (NCBI)