Products 21447-50-7

CAS 21447-50-7 is the registry number for 3-Amino-n-ethyl-4-methylbenzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

3-amino-N-ethyl-4-methylbenzamide;hydrochloride (CAS 21447-50-7) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: 3-amino-N-ethyl-4-methylbenzamide;hydrochloride. InChIKey: APNHCVSWBXRCNB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O
Molecular weight214.69 g/mol
IUPAC name3-amino-N-ethyl-4-methylbenzamide;hydrochloride
InChIKeyAPNHCVSWBXRCNB-UHFFFAOYSA-N
SMILESCCNC(=O)C1=CC(=C(C=C1)C)N.Cl

Computed by PubChem (NCBI)