CAS 1175301-88-8 is the registry number for (S)-1-(6-Chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanol (CAS 1175301-88-8) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: (1S)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanol. InChIKey: UCNWMDFVACNDNW-BYPYZUCNSA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | (1S)-1-(6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanol |
| InChIKey | UCNWMDFVACNDNW-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=NN=C2N1N=C(C=C2)Cl)O |
Computed by PubChem (NCBI)