CAS 1211499-84-1 is the registry number for 5-(Chloromethyl)-2-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-(chloromethyl)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 1211499-84-1) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: 5-(chloromethyl)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: XCZDLJSDOMTSQJ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | 5-(chloromethyl)-2-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | XCZDLJSDOMTSQJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=CC(=O)N2N1)CCl |
Computed by PubChem (NCBI)