CAS 2459488-99-2 is the registry number for 4-Chloro-5-methyl-5,8-dihydropteridin-7(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-methyl-6,8-dihydropteridin-7-one (CAS 2459488-99-2) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: 4-chloro-5-methyl-6,8-dihydropteridin-7-one. InChIKey: NNBSJAWKUNKESU-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | 4-chloro-5-methyl-6,8-dihydropteridin-7-one |
| InChIKey | NNBSJAWKUNKESU-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C1C(=NC=N2)Cl |
Computed by PubChem (NCBI)