CAS 16017-75-7 is the registry number for 2-Chloro-1,7-dimethyl-1H-purin-6(7H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1,7-dimethylpurin-6-one (CAS 16017-75-7) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: 2-chloro-1,7-dimethylpurin-6-one. InChIKey: BLSBCAJHDNITIC-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | 2-chloro-1,7-dimethylpurin-6-one |
| InChIKey | BLSBCAJHDNITIC-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C(=N2)Cl)C |
Computed by PubChem (NCBI)