Products 2379584-01-5
CAS 2379584-01-5 is the registry number for (S)-2-Chloro-7-methyl-7,8-dihydropteridin-6(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(7S)-2-chloro-7-methyl-7,8-dihydro-5H-pteridin-6-one (CAS 2379584-01-5) is a chemical compound with the molecular formula C7H7ClN4O and a molecular weight of 198.61 g/mol. IUPAC name: (7S)-2-chloro-7-methyl-7,8-dihydro-5H-pteridin-6-one. InChIKey: MEBDFIFJTXNNPZ-VKHMYHEASA-N.
| Molecular formula | C7H7ClN4O |
|---|---|
| Molecular weight | 198.61 g/mol |
| IUPAC name | (7S)-2-chloro-7-methyl-7,8-dihydro-5H-pteridin-6-one |
| InChIKey | MEBDFIFJTXNNPZ-VKHMYHEASA-N |
| SMILES | C[C@H]1C(=O)NC2=CN=C(N=C2N1)Cl |
Computed by PubChem (NCBI)