CAS 1175992-94-5 is the registry number for 1-(Methyl)-4-nitro-3-(2,2,3,3,3-D5-propyl)-1H-pyrazole-5-carboxylic Acid. Offered by: TRC. Available pack sizes: 50mg.
1-methyl-4-nitro-3-(2,2,3,3,3-pentadeuteriopropyl)pyrazole-5-carboxylic acid (CAS 1175992-94-5) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 218.22 g/mol. IUPAC name: 1-methyl-4-nitro-3-(2,2,3,3,3-pentadeuteriopropyl)pyrazole-5-carboxylic acid. InChIKey: GFORSNBMYCLGIE-WNWXXORZSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | 1-methyl-4-nitro-3-(2,2,3,3,3-pentadeuteriopropyl)pyrazole-5-carboxylic acid |
| InChIKey | GFORSNBMYCLGIE-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CC1=NN(C(=C1[N+](=O)[O-])C(=O)O)C |
Computed by PubChem (NCBI)