Products 526203-29-2

CAS 526203-29-2 is the registry number for 1-(Methyl-D3)-4-nitro-3-propyl-1H-pyrazole-5-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

4-nitro-3-propyl-1-(trideuteriomethyl)pyrazole-5-carboxylic acid (CAS 526203-29-2) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 216.21 g/mol. IUPAC name: 4-nitro-3-propyl-1-(trideuteriomethyl)pyrazole-5-carboxylic acid. InChIKey: GFORSNBMYCLGIE-BMSJAHLVSA-N.

Identity
Molecular formulaC8H11N3O4
Molecular weight216.21 g/mol
IUPAC name4-nitro-3-propyl-1-(trideuteriomethyl)pyrazole-5-carboxylic acid
InChIKeyGFORSNBMYCLGIE-BMSJAHLVSA-N
SMILES[2H]C([2H])([2H])N1C(=C(C(=N1)CCC)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)