CAS 526203-29-2 is the registry number for 1-(Methyl-D3)-4-nitro-3-propyl-1H-pyrazole-5-carboxylic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-nitro-3-propyl-1-(trideuteriomethyl)pyrazole-5-carboxylic acid (CAS 526203-29-2) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 216.21 g/mol. IUPAC name: 4-nitro-3-propyl-1-(trideuteriomethyl)pyrazole-5-carboxylic acid. InChIKey: GFORSNBMYCLGIE-BMSJAHLVSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 4-nitro-3-propyl-1-(trideuteriomethyl)pyrazole-5-carboxylic acid |
| InChIKey | GFORSNBMYCLGIE-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=C(C(=N1)CCC)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)