CAS 1176283-75-2 appears in our catalog under these names: Methyl 4-(2,2-difluoro-1-hydroxyethyl)benzoate, 95%, Methyl 4-(2,2-difluoro-1-hydroxyethyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-(2,2-difluoro-1-hydroxyethyl)benzoate (CAS 1176283-75-2) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: methyl 4-(2,2-difluoro-1-hydroxyethyl)benzoate. InChIKey: HUSZEWRGWATCRB-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | methyl 4-(2,2-difluoro-1-hydroxyethyl)benzoate |
| InChIKey | HUSZEWRGWATCRB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(C(F)F)O |
Computed by PubChem (NCBI)