Products 1176744-66-3
CAS 1176744-66-3 appears in our catalog under these names: (2E,4E)-4-(4,4-Dimethyl-2-pentyn-1-ylidene)-2-pentenedioic Acid 1,5-Dimethyl Ester, Terbinafine Impurity 33. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Dimethyl (E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-enedioate (CAS 1176744-66-3) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: dimethyl (E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-enedioate. InChIKey: DQDDYAHQEAEOHV-WSMCZHAYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | dimethyl (E,4E)-4-(4,4-dimethylpent-2-ynylidene)pent-2-enedioate |
| InChIKey | DQDDYAHQEAEOHV-WSMCZHAYSA-N |
| SMILES | CC(C)(C)C#C/C=C(\C=C\C(=O)OC)/C(=O)OC |
Computed by PubChem (NCBI)