CAS 1177285-27-6 appears in our catalog under these names: 4-Bromo-N,N-dimethyl-1,3-benzothiazol-2-amine, 95%, 4-Bromo-N,N-dimethyl-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-bromo-N,N-dimethyl-1,3-benzothiazol-2-amine (CAS 1177285-27-6) is a chemical compound with the molecular formula C9H9BrN2S and a molecular weight of 257.15 g/mol. IUPAC name: 4-bromo-N,N-dimethyl-1,3-benzothiazol-2-amine. InChIKey: OIEPTKBXWDYGHL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2S |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 4-bromo-N,N-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | OIEPTKBXWDYGHL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(S1)C=CC=C2Br |
Computed by PubChem (NCBI)