CAS 918792-84-4 is the registry number for 5-Bromo-2-(2,5-dimethyl-1H-pyrrol-1-yl)thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazole (CAS 918792-84-4) is a chemical compound with the molecular formula C9H9BrN2S and a molecular weight of 257.15 g/mol. IUPAC name: 5-bromo-2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazole. InChIKey: NTVKNAYKEZCLHE-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2S |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 5-bromo-2-(2,5-dimethylpyrrol-1-yl)-1,3-thiazole |
| InChIKey | NTVKNAYKEZCLHE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=NC=C(S2)Br)C |
Computed by PubChem (NCBI)