CAS 2621939-22-6 is the registry number for 4-Bromo-5,6-dimethylbenzo[d]thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5,6-dimethyl-1,3-benzothiazol-2-amine (CAS 2621939-22-6) is a chemical compound with the molecular formula C9H9BrN2S and a molecular weight of 257.15 g/mol. IUPAC name: 4-bromo-5,6-dimethyl-1,3-benzothiazol-2-amine. InChIKey: WQGLMPQAYRXADR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2S |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 4-bromo-5,6-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | WQGLMPQAYRXADR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1C)Br)N=C(S2)N |
Computed by PubChem (NCBI)