CAS 383131-01-9 appears in our catalog under these names: 4-Bromo-6,7-dimethyl-1,3-benzothiazol-2-amine, 97%, 4-Bromo-6,7-dimethyl-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
4-bromo-6,7-dimethyl-1,3-benzothiazol-2-amine (CAS 383131-01-9) is a chemical compound with the molecular formula C9H9BrN2S and a molecular weight of 257.15 g/mol. IUPAC name: 4-bromo-6,7-dimethyl-1,3-benzothiazol-2-amine. InChIKey: IRDFNBXUAHBVNA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2S |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 4-bromo-6,7-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | IRDFNBXUAHBVNA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1C)SC(=N2)N)Br |
Computed by PubChem (NCBI)