Products 728885-92-5
CAS 728885-92-5 is the registry number for 3-Bromo-6-ethyl-5-methylisothiazolo[5,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-6-ethyl-5-methyl-[1,2]thiazolo[5,4-b]pyridine (CAS 728885-92-5) is a chemical compound with the molecular formula C9H9BrN2S and a molecular weight of 257.15 g/mol. IUPAC name: 3-bromo-6-ethyl-5-methyl-[1,2]thiazolo[5,4-b]pyridine. InChIKey: LCAOSAKZHGENGR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2S |
|---|---|
| Molecular weight | 257.15 g/mol |
| IUPAC name | 3-bromo-6-ethyl-5-methyl-[1,2]thiazolo[5,4-b]pyridine |
| InChIKey | LCAOSAKZHGENGR-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C=C1C)C(=NS2)Br |
Computed by PubChem (NCBI)