CAS 1177325-89-1 appears in our catalog under these names: 6-Bromo-2-chloro-4-methyl-1,3-benzothiazole, 95%, 6-Bromo-2-chloro-4-methylbenzo(d)thiazole, 97%, 6-Bromo-2-chloro-4-methyl-1,3-benzothiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
6-bromo-2-chloro-4-methyl-1,3-benzothiazole (CAS 1177325-89-1) is a chemical compound with the molecular formula C8H5BrClNS and a molecular weight of 262.55 g/mol. IUPAC name: 6-bromo-2-chloro-4-methyl-1,3-benzothiazole. InChIKey: MIOUEGRJFWZAER-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNS |
|---|---|
| Molecular weight | 262.55 g/mol |
| IUPAC name | 6-bromo-2-chloro-4-methyl-1,3-benzothiazole |
| InChIKey | MIOUEGRJFWZAER-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(S2)Cl)Br |
Computed by PubChem (NCBI)