Products 209286-63-5
CAS 209286-63-5 appears in our catalog under these names: 2-(Bromomethyl)-4-chlorothieno(3,2-c)pyridine, 98%, 2–(Bromomethyl)–4–chlorothieno(3，2–c)pyridine, 2-(Bromomethyl)-4-chlorothieno[3,2-c]pyridine, 96%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-(bromomethyl)-4-chlorothieno[3,2-c]pyridine (CAS 209286-63-5) is a chemical compound with the molecular formula C8H5BrClNS and a molecular weight of 262.55 g/mol. IUPAC name: 2-(bromomethyl)-4-chlorothieno[3,2-c]pyridine. InChIKey: WFAPVCILZFJNIT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNS |
|---|---|
| Molecular weight | 262.55 g/mol |
| IUPAC name | 2-(bromomethyl)-4-chlorothieno[3,2-c]pyridine |
| InChIKey | WFAPVCILZFJNIT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1SC(=C2)CBr)Cl |
Computed by PubChem (NCBI)