CAS 898748-08-8 is the registry number for 2-Bromo-7-chloro-4-methyl-1,3-benzothiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-bromo-7-chloro-4-methyl-1,3-benzothiazole (CAS 898748-08-8) is a chemical compound with the molecular formula C8H5BrClNS and a molecular weight of 262.55 g/mol. IUPAC name: 2-bromo-7-chloro-4-methyl-1,3-benzothiazole. InChIKey: JHOQELSQTXEIIE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNS |
|---|---|
| Molecular weight | 262.55 g/mol |
| IUPAC name | 2-bromo-7-chloro-4-methyl-1,3-benzothiazole |
| InChIKey | JHOQELSQTXEIIE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Cl)SC(=N2)Br |
Computed by PubChem (NCBI)