CAS 886501-19-5 appears in our catalog under these names: 4-Bromo-5-chloro-2-methylphenylisothiocyanate, 95%, 4-Bromo-5-chloro-2-methylphenyl isothiocyanate, 97%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
1-bromo-2-chloro-4-isothiocyanato-5-methylbenzene (CAS 886501-19-5) is a chemical compound with the molecular formula C8H5BrClNS and a molecular weight of 262.55 g/mol. IUPAC name: 1-bromo-2-chloro-4-isothiocyanato-5-methylbenzene. InChIKey: KWMYSOAUHVIFPE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNS |
|---|---|
| Molecular weight | 262.55 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-isothiocyanato-5-methylbenzene |
| InChIKey | KWMYSOAUHVIFPE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N=C=S)Cl)Br |
Computed by PubChem (NCBI)