CAS 143163-72-8 appears in our catalog under these names: 2-(Bromomethyl)-5-chlorobenzo(d)thiazole, 95%, 2-(Bromomethyl)-5-chloro-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(bromomethyl)-5-chloro-1,3-benzothiazole (CAS 143163-72-8) is a chemical compound with the molecular formula C8H5BrClNS and a molecular weight of 262.55 g/mol. IUPAC name: 2-(bromomethyl)-5-chloro-1,3-benzothiazole. InChIKey: ICZQQYOEDNQIAD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClNS |
|---|---|
| Molecular weight | 262.55 g/mol |
| IUPAC name | 2-(bromomethyl)-5-chloro-1,3-benzothiazole |
| InChIKey | ICZQQYOEDNQIAD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(S2)CBr |
Computed by PubChem (NCBI)