CAS 1178127-98-4 appears in our catalog under these names: 4-(Cyclopropylamino)-3-methylbenzonitrile, 4-(Cyclopropylamino)-3-methylbenzonitrile, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-(cyclopropylamino)-3-methylbenzonitrile (CAS 1178127-98-4) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 4-(cyclopropylamino)-3-methylbenzonitrile. InChIKey: HXAWXHSGVPCOQX-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 4-(cyclopropylamino)-3-methylbenzonitrile |
| InChIKey | HXAWXHSGVPCOQX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C#N)NC2CC2 |
Computed by PubChem (NCBI)