CAS 1178134-86-5 is the registry number for 4-(4-Amino-phenoxy)-pyridine-2-carboxylic acid methylamide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide (CAS 1178134-86-5) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide. InChIKey: RXZZBPYPZLAEFC-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide |
| InChIKey | RXZZBPYPZLAEFC-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)