CAS 284462-37-9 appears in our catalog under these names: Sorafenib Impurity 5, Sorafenib EP Impurity A, (4-(4-Aminophenoxy)(2-pyridyl))-N-methylcarboxamide, >95% (HPLC), 4–(4–Aminophenoxy)–N–methyl–2–pyridinecarboxamide, (4-(4-Aminophenoxy)(2-pyridyl))-N-methylcarboxamide. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 1g, 250mg, 5g, 100g, 25g, 2g, 10g.
4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide (CAS 284462-37-9) is a chemical compound with the molecular formula C13H13N3O2 and a molecular weight of 243.26 g/mol. IUPAC name: 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide. InChIKey: RXZZBPYPZLAEFC-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O2 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 4-(4-aminophenoxy)-N-methylpyridine-2-carboxamide |
| InChIKey | RXZZBPYPZLAEFC-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)