CAS 117820-80-1 appears in our catalog under these names: 3,5–Dichloro–4–fluorobenzaldehyde, 3,5-Dichloro-4-fluorobenzaldehyde 98%, 3,5-Dichloro-4-fluorobenzaldehyde, 97%, 97%, 3,5-Dichloro-4-fluorobenzaldehyde, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 100g.
3,5-dichloro-4-fluorobenzaldehyde (CAS 117820-80-1) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 3,5-dichloro-4-fluorobenzaldehyde. InChIKey: HQMAHFRNJCBIGV-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 3,5-dichloro-4-fluorobenzaldehyde |
| InChIKey | HQMAHFRNJCBIGV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)C=O |
Computed by PubChem (NCBI)