CAS 117857-95-1 appears in our catalog under these names: L-CCG-IV, L–CCG–lll, cis-α-(Carboxycyclopropyl)glycine. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 200mg, 10mg, 5mg, 2,5mg, 1 mg.
Cis-(1S,2R)-2-[(S)-amino(carboxy)methyl]cyclopropane-1-carboxylic acid (CAS 117857-95-1) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: cis-(1S,2R)-2-[(S)-amino(carboxy)methyl]cyclopropane-1-carboxylic acid. InChIKey: GZOVEPYOCJWRFC-UZBSEBFBSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(S)-amino(carboxy)methyl]cyclopropane-1-carboxylic acid |
| InChIKey | GZOVEPYOCJWRFC-UZBSEBFBSA-N |
| SMILES | C1[C@H]([C@H]1C(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)